C20H29N3O2 — CID 97366433
(3R,4aR,8aS)-6-(cyclopropylmethyl)-N-methyl-N-(pyridin-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide (PubChem CID 97366433) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is (3R,4aR,8aS)-6-(cyclopropylmethyl)-N-methyl-N-(pyridin-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide.
| Compound Name | (3R,4aR,8aS)-6-(cyclopropylmethyl)-N-methyl-N-(pyridin-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 97366433 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | (3R,4aR,8aS)-6-(cyclopropylmethyl)-N-methyl-N-(pyridin-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide |
| SMILES | CN(Cc1ccccn1)C(=O)[C@H]1CO[C@H]2CCN(CC3CC3)C[C@H]2C1 |
| InChI | InChI=1S/C20H29N3O2/c1-22(13-18-4-2-3-8-21-18)20(24)17-10-16-12-23(11-15-5-6-15)9-7-19(16)25-14-17/h2-4,8,15-17,19H,5-7,9-14H2,1H3/t16-,17-,19+/m1/s1 |
| InChIKey | KWAKGTCIXFXSTD-LMMKCTJWSA-N |
| XLogP | 2.18 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |