C15H22N4O3 — CID 97366895
(2R,3aS,7aR)-N-(2-methoxyethyl)-6-pyrimidin-2-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide (PubChem CID 97366895) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is (2R,3aS,7aR)-N-(2-methoxyethyl)-6-pyrimidin-2-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide.
| Compound Name | (2R,3aS,7aR)-N-(2-methoxyethyl)-6-pyrimidin-2-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 97366895 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (2R,3aS,7aR)-N-(2-methoxyethyl)-6-pyrimidin-2-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide |
| SMILES | COCCNC(=O)[C@H]1C[C@@H]2CCN(c3ncccn3)C[C@@H]2O1 |
| InChI | InChI=1S/C15H22N4O3/c1-21-8-6-16-14(20)12-9-11-3-7-19(10-13(11)22-12)15-17-4-2-5-18-15/h2,4-5,11-13H,3,6-10H2,1H3,(H,16,20)/t11-,12+,13-/m0/s1 |
| InChIKey | BVUPHYNUPZFXPP-XQQFMLRXSA-N |
| XLogP | 0.22 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|