C17H28N2O4 — CID 97366923
[(2R,3aS,7aR)-6-(oxan-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-morpholin-4-ylmethanone (PubChem CID 97366923) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is [(2R,3aS,7aR)-6-(oxan-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [(2R,3aS,7aR)-6-(oxan-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 97366923 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | [(2R,3aS,7aR)-6-(oxan-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-morpholin-4-ylmethanone |
| SMILES | O=C([C@H]1C[C@@H]2CCN(C3CCOCC3)C[C@@H]2O1)N1CCOCC1 |
| InChI | InChI=1S/C17H28N2O4/c20-17(18-5-9-22-10-6-18)15-11-13-1-4-19(12-16(13)23-15)14-2-7-21-8-3-14/h13-16H,1-12H2/t13-,15+,16-/m0/s1 |
| InChIKey | TWUXQYQAPAIYGP-IMJJTQAJSA-N |
| XLogP | 0.50 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |