C20H30N2O3 — CID 97367029
(4R,4aR,8aR)-N,N-dimethyl-6-(2-phenylmethoxyethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide (PubChem CID 97367029) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is (4R,4aR,8aR)-N,N-dimethyl-6-(2-phenylmethoxyethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide.
| Compound Name | (4R,4aR,8aR)-N,N-dimethyl-6-(2-phenylmethoxyethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 97367029 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | (4R,4aR,8aR)-N,N-dimethyl-6-(2-phenylmethoxyethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide |
| SMILES | CN(C)C(=O)[C@@H]1CCO[C@@H]2CCN(CCOCc3ccccc3)C[C@H]21 |
| InChI | InChI=1S/C20H30N2O3/c1-21(2)20(23)17-9-12-25-19-8-10-22(14-18(17)19)11-13-24-15-16-6-4-3-5-7-16/h3-7,17-19H,8-15H2,1-2H3/t17-,18+,19-/m1/s1 |
| InChIKey | LJIVKFIVKVQQJR-CEXWTWQISA-N |
| XLogP | 2.02 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|