C16H21FN4O3 — CID 97367107
[(4R,4aR,8aR)-6-(5-fluoropyrimidin-2-yl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-yl]-(1,2-oxazolidin-2-yl)methanone (PubChem CID 97367107) has the molecular formula C16H21FN4O3 and a molecular weight of 336.37 g/mol. Its IUPAC name is [(4R,4aR,8aR)-6-(5-fluoropyrimidin-2-yl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-yl]-(1,2-oxazolidin-2-yl)methanone.
| Compound Name | [(4R,4aR,8aR)-6-(5-fluoropyrimidin-2-yl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-yl]-(1,2-oxazolidin-2-yl)methanone |
|---|---|
| PubChem CID | 97367107 |
| Molecular Formula | C16H21FN4O3 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | [(4R,4aR,8aR)-6-(5-fluoropyrimidin-2-yl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-yl]-(1,2-oxazolidin-2-yl)methanone |
| SMILES | O=C([C@@H]1CCO[C@@H]2CCN(c3ncc(F)cn3)C[C@H]21)N1CCCO1 |
| InChI | InChI=1S/C16H21FN4O3/c17-11-8-18-16(19-9-11)20-5-2-14-13(10-20)12(3-7-23-14)15(22)21-4-1-6-24-21/h8-9,12-14H,1-7,10H2/t12-,13+,14-/m1/s1 |
| InChIKey | ZCIXRRAALOZWPD-HZSPNIEDSA-N |
| XLogP | 1.01 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |