C17H28N4O3 — CID 97367141
(4R,4aS,8aR)-N-(2-methoxyethyl)-6-[(1-methylpyrazol-4-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide (PubChem CID 97367141) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is (4R,4aS,8aR)-N-(2-methoxyethyl)-6-[(1-methylpyrazol-4-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide.
| Compound Name | (4R,4aS,8aR)-N-(2-methoxyethyl)-6-[(1-methylpyrazol-4-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 97367141 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | (4R,4aS,8aR)-N-(2-methoxyethyl)-6-[(1-methylpyrazol-4-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1CCO[C@@H]2CCN(Cc3cnn(C)c3)C[C@@H]21 |
| InChI | InChI=1S/C17H28N4O3/c1-20-10-13(9-19-20)11-21-6-3-16-15(12-21)14(4-7-24-16)17(22)18-5-8-23-2/h9-10,14-16H,3-8,11-12H2,1-2H3,(H,18,22)/t14-,15-,16-/m1/s1 |
| InChIKey | AWYGTILRAYKIDA-BZUAXINKSA-N |
| XLogP | 0.41 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|