C15H23N3O2S — CID 97367181
(4R,4aS,8aR)-N-methyl-6-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide (PubChem CID 97367181) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is (4R,4aS,8aR)-N-methyl-6-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide.
| Compound Name | (4R,4aS,8aR)-N-methyl-6-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 97367181 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (4R,4aS,8aR)-N-methyl-6-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide |
| SMILES | CNC(=O)[C@@H]1CCO[C@@H]2CCN(Cc3scnc3C)C[C@@H]21 |
| InChI | InChI=1S/C15H23N3O2S/c1-10-14(21-9-17-10)8-18-5-3-13-12(7-18)11(4-6-20-13)15(19)16-2/h9,11-13H,3-8H2,1-2H3,(H,16,19)/t11-,12-,13-/m1/s1 |
| InChIKey | IZBZASIUIJIVHJ-JHJVBQTASA-N |
| XLogP | 1.42 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |