C11H19NO4S — CID 97367305
1-[(2S,3aS,7aR)-2-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-2-methylsulfonylethanone (PubChem CID 97367305) has the molecular formula C11H19NO4S and a molecular weight of 261.34 g/mol. Its IUPAC name is 1-[(2S,3aS,7aR)-2-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-2-methylsulfonylethanone.
| Compound Name | 1-[(2S,3aS,7aR)-2-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-2-methylsulfonylethanone |
|---|---|
| PubChem CID | 97367305 |
| Molecular Formula | C11H19NO4S |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 1-[(2S,3aS,7aR)-2-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-2-methylsulfonylethanone |
| SMILES | C[C@H]1C[C@H]2CN(C(=O)CS(C)(=O)=O)CC[C@H]2O1 |
| InChI | InChI=1S/C11H19NO4S/c1-8-5-9-6-12(4-3-10(9)16-8)11(13)7-17(2,14)15/h8-10H,3-7H2,1-2H3/t8-,9-,10+/m0/s1 |
| InChIKey | MQDOGJWHNFCVML-LPEHRKFASA-N |
| XLogP | 0.06 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |