C14H20N2O — CID 97369322
(2S,3aS,7aS)-2-methyl-5-(pyridin-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine (PubChem CID 97369322) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is (2S,3aS,7aS)-2-methyl-5-(pyridin-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine.
| Compound Name | (2S,3aS,7aS)-2-methyl-5-(pyridin-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine |
|---|---|
| PubChem CID | 97369322 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | (2S,3aS,7aS)-2-methyl-5-(pyridin-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine |
| SMILES | C[C@H]1C[C@H]2CN(Cc3ccccn3)CC[C@@H]2O1 |
| InChI | InChI=1S/C14H20N2O/c1-11-8-12-9-16(7-5-14(12)17-11)10-13-4-2-3-6-15-13/h2-4,6,11-12,14H,5,7-10H2,1H3/t11-,12-,14-/m0/s1 |
| InChIKey | YJUILXHWEKGUKU-OBJOEFQTSA-N |
| XLogP | 2.08 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |