C17H21N3O3S — CID 97369419
[(2R,3aS,7aS)-2-(4,5-dimethyl-1,3-thiazol-2-yl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-(5-methyl-1,2-oxazol-4-yl)methanone (PubChem CID 97369419) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is [(2R,3aS,7aS)-2-(4,5-dimethyl-1,3-thiazol-2-yl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-(5-methyl-1,2-oxazol-4-yl)methanone.
| Compound Name | [(2R,3aS,7aS)-2-(4,5-dimethyl-1,3-thiazol-2-yl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-(5-methyl-1,2-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 97369419 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | [(2R,3aS,7aS)-2-(4,5-dimethyl-1,3-thiazol-2-yl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-(5-methyl-1,2-oxazol-4-yl)methanone |
| SMILES | Cc1nc([C@H]2C[C@H]3CN(C(=O)c4cnoc4C)CC[C@@H]3O2)sc1C |
| InChI | InChI=1S/C17H21N3O3S/c1-9-11(3)24-16(19-9)15-6-12-8-20(5-4-14(12)22-15)17(21)13-7-18-23-10(13)2/h7,12,14-15H,4-6,8H2,1-3H3/t12-,14-,15+/m0/s1 |
| InChIKey | YKDLQLBWHMFMRH-AEGPPILISA-N |
| XLogP | 3.05 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |