C15H22N6O — CID 97369608
(2R,3aS,7aS)-6-[(1-methylpyrazol-4-yl)methyl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine (PubChem CID 97369608) has the molecular formula C15H22N6O and a molecular weight of 302.38 g/mol. Its IUPAC name is (2R,3aS,7aS)-6-[(1-methylpyrazol-4-yl)methyl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine.
| Compound Name | (2R,3aS,7aS)-6-[(1-methylpyrazol-4-yl)methyl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine |
|---|---|
| PubChem CID | 97369608 |
| Molecular Formula | C15H22N6O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (2R,3aS,7aS)-6-[(1-methylpyrazol-4-yl)methyl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine |
| SMILES | Cc1nc([C@H]2C[C@@H]3CCN(Cc4cnn(C)c4)C[C@H]3O2)n[nH]1 |
| InChI | InChI=1S/C15H22N6O/c1-10-17-15(19-18-10)13-5-12-3-4-21(9-14(12)22-13)8-11-6-16-20(2)7-11/h6-7,12-14H,3-5,8-9H2,1-2H3,(H,17,18,19)/t12-,13+,14+/m0/s1 |
| InChIKey | UCBQKWTWXBYOCC-BFHYXJOUSA-N |
| XLogP | 1.20 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |