C15H22N2O — CID 97369642
(2R,3aS,7aS)-2-methyl-6-[(6-methyl-2-pyridinyl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine (PubChem CID 97369642) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is (2R,3aS,7aS)-2-methyl-6-[(6-methyl-2-pyridinyl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine.
| Compound Name | (2R,3aS,7aS)-2-methyl-6-[(6-methyl-2-pyridinyl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine |
|---|---|
| PubChem CID | 97369642 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | (2R,3aS,7aS)-2-methyl-6-[(6-methyl-2-pyridinyl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine |
| SMILES | Cc1cccc(CN2CC[C@H]3C[C@@H](C)O[C@@H]3C2)n1 |
| InChI | InChI=1S/C15H22N2O/c1-11-4-3-5-14(16-11)9-17-7-6-13-8-12(2)18-15(13)10-17/h3-5,12-13,15H,6-10H2,1-2H3/t12-,13+,15-/m1/s1 |
| InChIKey | GDUVXQZJDDWPBZ-VNHYZAJKSA-N |
| XLogP | 2.39 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |