C18H24N4OS — CID 97369711
(2S,3aS,7aS)-2-(4-cyclopropyl-1,3-thiazol-2-yl)-6-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine (PubChem CID 97369711) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is (2S,3aS,7aS)-2-(4-cyclopropyl-1,3-thiazol-2-yl)-6-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine.
| Compound Name | (2S,3aS,7aS)-2-(4-cyclopropyl-1,3-thiazol-2-yl)-6-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine |
|---|---|
| PubChem CID | 97369711 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (2S,3aS,7aS)-2-(4-cyclopropyl-1,3-thiazol-2-yl)-6-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine |
| SMILES | Cn1cc(CN2CC[C@H]3C[C@@H](c4nc(C5CC5)cs4)O[C@@H]3C2)cn1 |
| InChI | InChI=1S/C18H24N4OS/c1-21-8-12(7-19-21)9-22-5-4-14-6-16(23-17(14)10-22)18-20-15(11-24-18)13-2-3-13/h7-8,11,13-14,16-17H,2-6,9-10H2,1H3/t14-,16-,17+/m0/s1 |
| InChIKey | LPGPBLHAGRQEJI-BHYGNILZSA-N |
| XLogP | 3.11 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |