C14H23N3O2 — CID 97370234
N,N-dimethyl-1-oxo-2-prop-2-enyl-2,8-diazaspiro[4.5]decane-8-carboxamide (PubChem CID 97370234) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is N,N-dimethyl-1-oxo-2-prop-2-enyl-2,8-diazaspiro[4.5]decane-8-carboxamide.
| Compound Name | N,N-dimethyl-1-oxo-2-prop-2-enyl-2,8-diazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 97370234 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | N,N-dimethyl-1-oxo-2-prop-2-enyl-2,8-diazaspiro[4.5]decane-8-carboxamide |
| SMILES | C=CCN1CCC2(CCN(C(=O)N(C)C)CC2)C1=O |
| InChI | InChI=1S/C14H23N3O2/c1-4-8-16-9-5-14(12(16)18)6-10-17(11-7-14)13(19)15(2)3/h4H,1,5-11H2,2-3H3 |
| InChIKey | MCHXWFUIZLDMHZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|