C20H24N4O — CID 97371955
(5R)-2,9-bis(pyridin-4-ylmethyl)-2,9-diazaspiro[4.5]decan-1-one (PubChem CID 97371955) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is (5R)-2,9-bis(pyridin-4-ylmethyl)-2,9-diazaspiro[4.5]decan-1-one.
| Compound Name | (5R)-2,9-bis(pyridin-4-ylmethyl)-2,9-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 97371955 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (5R)-2,9-bis(pyridin-4-ylmethyl)-2,9-diazaspiro[4.5]decan-1-one |
| SMILES | O=C1N(Cc2ccncc2)CC[C@@]12CCCN(Cc1ccncc1)C2 |
| InChI | InChI=1S/C20H24N4O/c25-19-20(7-13-24(19)15-18-4-10-22-11-5-18)6-1-12-23(16-20)14-17-2-8-21-9-3-17/h2-5,8-11H,1,6-7,12-16H2/t20-/m1/s1 |
| InChIKey | JOBJQFYINKXKOW-HXUWFJFHSA-N |
| XLogP | 2.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |