About N-propan-2-yl-1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxamide
N-propan-2-yl-1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxamide (PubChem CID 97372210) has the molecular formula C12H23N3O2
and a molecular weight of 241.33 g/mol. Its IUPAC name is N-propan-2-yl-1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxamide.
Molecular Properties
| Compound Name | N-propan-2-yl-1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxamide |
| PubChem CID | 97372210 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | N-propan-2-yl-1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxamide |
| SMILES | CC(C)NC(=O)N1CCOC2(CCNCC2)C1 |
| InChI | InChI=1S/C12H23N3O2/c1-10(2)14-11(16)15-7-8-17-12(9-15)3-5-13-6-4-12/h10,13H,3-9H2,1-2H3,(H,14,16) |
| InChIKey | VKRAXDZAYFCQBG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-propan-2-yl-1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-yl-1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxamide?
The IUPAC name of N-propan-2-yl-1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxamide (CID 97372210) is N-propan-2-yl-1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxamide.
What is the SMILES notation for N-propan-2-yl-1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxamide?
The canonical SMILES for N-propan-2-yl-1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxamide is CC(C)NC(=O)N1CCOC2(CCNCC2)C1.
What is the InChIKey of N-propan-2-yl-1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxamide?
The InChIKey is VKRAXDZAYFCQBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O2/c1-10(2)14-11(16)15-7-8-17-12(9-15)3-5-13-6-4-12/h10,13H,3-9H2,1-2H3,(H,14,16).
What are the key properties of N-propan-2-yl-1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxamide?
N-propan-2-yl-1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxamide has a molecular weight of 241.33 g/mol, XLogP of 0.56, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-yl-1-oxa-4,9-diazaspiro[5.5]undecane-4-carboxamide is sourced from PubChem (CID 97372210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).