C16H22N4OS2 — CID 97372261
4,9-bis(1,3-thiazol-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecane (PubChem CID 97372261) has the molecular formula C16H22N4OS2 and a molecular weight of 350.51 g/mol. Its IUPAC name is 4,9-bis(1,3-thiazol-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecane.
| Compound Name | 4,9-bis(1,3-thiazol-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 97372261 |
| Molecular Formula | C16H22N4OS2 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 4,9-bis(1,3-thiazol-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecane |
| SMILES | c1csc(CN2CCC3(CC2)CN(Cc2nccs2)CCO3)n1 |
| InChI | InChI=1S/C16H22N4OS2/c1-5-19(11-14-17-3-9-22-14)6-2-16(1)13-20(7-8-21-16)12-15-18-4-10-23-15/h3-4,9-10H,1-2,5-8,11-13H2 |
| InChIKey | DTOZGRGRRHZUEH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |