C17H18N2O2S2 — CID 973724
ethyl (4S,5S)-5-cyano-2-methyl-5-prop-2-enyl-6-sulfanylidene-4-thiophen-2-yl-1,4-dihydropyridine-3-carboxylate (PubChem CID 973724) has the molecular formula C17H18N2O2S2 and a molecular weight of 346.48 g/mol. Its IUPAC name is ethyl (4S,5S)-5-cyano-2-methyl-5-prop-2-enyl-6-sulfanylidene-4-thiophen-2-yl-1,4-dihydropyridine-3-carboxylate.
| Compound Name | ethyl (4S,5S)-5-cyano-2-methyl-5-prop-2-enyl-6-sulfanylidene-4-thiophen-2-yl-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 973724 |
| Molecular Formula | C17H18N2O2S2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | ethyl (4S,5S)-5-cyano-2-methyl-5-prop-2-enyl-6-sulfanylidene-4-thiophen-2-yl-1,4-dihydropyridine-3-carboxylate |
| SMILES | C=CC[C@]1(C#N)C(=S)NC(C)=C(C(=O)OCC)[C@@H]1c1cccs1 |
| InChI | InChI=1S/C17H18N2O2S2/c1-4-8-17(10-18)14(12-7-6-9-23-12)13(15(20)21-5-2)11(3)19-16(17)22/h4,6-7,9,14H,1,5,8H2,2-3H3,(H,19,22)/t14-,17+/m0/s1 |
| InChIKey | OBNQAGAKVGGLCA-WMLDXEAASA-N |
| XLogP | 3.69 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|