C17H23N3O3 — CID 97373327
9-(furan-2-carbonyl)-1-methyl-4-prop-2-enyl-1,4,9-triazaspiro[5.5]undecan-5-one (PubChem CID 97373327) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 9-(furan-2-carbonyl)-1-methyl-4-prop-2-enyl-1,4,9-triazaspiro[5.5]undecan-5-one.
| Compound Name | 9-(furan-2-carbonyl)-1-methyl-4-prop-2-enyl-1,4,9-triazaspiro[5.5]undecan-5-one |
|---|---|
| PubChem CID | 97373327 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 9-(furan-2-carbonyl)-1-methyl-4-prop-2-enyl-1,4,9-triazaspiro[5.5]undecan-5-one |
| SMILES | C=CCN1CCN(C)C2(CCN(C(=O)c3ccco3)CC2)C1=O |
| InChI | InChI=1S/C17H23N3O3/c1-3-8-20-12-11-18(2)17(16(20)22)6-9-19(10-7-17)15(21)14-5-4-13-23-14/h3-5,13H,1,6-12H2,2H3 |
| InChIKey | XGMPUAVCZMHJFR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|