About [(4R)-1,8-diazaspiro[3.5]nonan-1-yl]-pyrimidin-4-ylmethanone
[(4R)-1,8-diazaspiro[3.5]nonan-1-yl]-pyrimidin-4-ylmethanone (PubChem CID 97374226) has the molecular formula C12H16N4O
and a molecular weight of 232.29 g/mol. Its IUPAC name is [(4R)-1,8-diazaspiro[3.5]nonan-1-yl]-pyrimidin-4-ylmethanone.
Molecular Properties
| Compound Name | [(4R)-1,8-diazaspiro[3.5]nonan-1-yl]-pyrimidin-4-ylmethanone |
| PubChem CID | 97374226 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | [(4R)-1,8-diazaspiro[3.5]nonan-1-yl]-pyrimidin-4-ylmethanone |
| SMILES | O=C(c1ccncn1)N1CC[C@@]12CCCNC2 |
| InChI | InChI=1S/C12H16N4O/c17-11(10-2-6-14-9-15-10)16-7-4-12(16)3-1-5-13-8-12/h2,6,9,13H,1,3-5,7-8H2/t12-/m1/s1 |
| InChIKey | AHVNZKQVWIQDAQ-GFCCVEGCSA-N |
| XLogP | 0.44 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(4R)-1,8-diazaspiro[3.5]nonan-1-yl]-pyrimidin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R)-1,8-diazaspiro[3.5]nonan-1-yl]-pyrimidin-4-ylmethanone?
The IUPAC name of [(4R)-1,8-diazaspiro[3.5]nonan-1-yl]-pyrimidin-4-ylmethanone (CID 97374226) is [(4R)-1,8-diazaspiro[3.5]nonan-1-yl]-pyrimidin-4-ylmethanone.
What is the SMILES notation for [(4R)-1,8-diazaspiro[3.5]nonan-1-yl]-pyrimidin-4-ylmethanone?
The canonical SMILES for [(4R)-1,8-diazaspiro[3.5]nonan-1-yl]-pyrimidin-4-ylmethanone is O=C(c1ccncn1)N1CC[C@@]12CCCNC2.
What is the InChIKey of [(4R)-1,8-diazaspiro[3.5]nonan-1-yl]-pyrimidin-4-ylmethanone?
The InChIKey is AHVNZKQVWIQDAQ-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H16N4O/c17-11(10-2-6-14-9-15-10)16-7-4-12(16)3-1-5-13-8-12/h2,6,9,13H,1,3-5,7-8H2/t12-/m1/s1.
What are the key properties of [(4R)-1,8-diazaspiro[3.5]nonan-1-yl]-pyrimidin-4-ylmethanone?
[(4R)-1,8-diazaspiro[3.5]nonan-1-yl]-pyrimidin-4-ylmethanone has a molecular weight of 232.29 g/mol, XLogP of 0.44, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R)-1,8-diazaspiro[3.5]nonan-1-yl]-pyrimidin-4-ylmethanone is sourced from PubChem (CID 97374226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).