C12H16N4O — CID 97374226
[(4R)-1,8-diazaspiro[3.5]nonan-1-yl]-pyrimidin-4-ylmethanone (PubChem CID 97374226) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is [(4R)-1,8-diazaspiro[3.5]nonan-1-yl]-pyrimidin-4-ylmethanone.
| Compound Name | [(4R)-1,8-diazaspiro[3.5]nonan-1-yl]-pyrimidin-4-ylmethanone |
|---|---|
| PubChem CID | 97374226 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | [(4R)-1,8-diazaspiro[3.5]nonan-1-yl]-pyrimidin-4-ylmethanone |
| SMILES | O=C(c1ccncn1)N1CC[C@@]12CCCNC2 |
| InChI | InChI=1S/C12H16N4O/c17-11(10-2-6-14-9-15-10)16-7-4-12(16)3-1-5-13-8-12/h2,6,9,13H,1,3-5,7-8H2/t12-/m1/s1 |
| InChIKey | AHVNZKQVWIQDAQ-GFCCVEGCSA-N |
| XLogP | 0.44 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |