C20H24N2O4S — CID 97374923
N-[(3S)-7-(5-methylfuran-2-carbonyl)-7-azaspiro[3.5]nonan-3-yl]benzenesulfonamide (PubChem CID 97374923) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is N-[(3S)-7-(5-methylfuran-2-carbonyl)-7-azaspiro[3.5]nonan-3-yl]benzenesulfonamide.
| Compound Name | N-[(3S)-7-(5-methylfuran-2-carbonyl)-7-azaspiro[3.5]nonan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 97374923 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | N-[(3S)-7-(5-methylfuran-2-carbonyl)-7-azaspiro[3.5]nonan-3-yl]benzenesulfonamide |
| SMILES | Cc1ccc(C(=O)N2CCC3(CC[C@@H]3NS(=O)(=O)c3ccccc3)CC2)o1 |
| InChI | InChI=1S/C20H24N2O4S/c1-15-7-8-17(26-15)19(23)22-13-11-20(12-14-22)10-9-18(20)21-27(24,25)16-5-3-2-4-6-16/h2-8,18,21H,9-14H2,1H3/t18-/m0/s1 |
| InChIKey | XSEZAYWGRJLYQW-SFHVURJKSA-N |
| XLogP | 2.95 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |