About 1-(4-amino-2-anilino-1,3-thiazol-5-yl)-2,2-dimethylpropan-1-one
1-(4-amino-2-anilino-1,3-thiazol-5-yl)-2,2-dimethylpropan-1-one (PubChem CID 973752) has the molecular formula C14H17N3OS
and a molecular weight of 275.38 g/mol. Its IUPAC name is 1-(4-amino-2-anilino-1,3-thiazol-5-yl)-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 1-(4-amino-2-anilino-1,3-thiazol-5-yl)-2,2-dimethylpropan-1-one |
| PubChem CID | 973752 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 1-(4-amino-2-anilino-1,3-thiazol-5-yl)-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)c1sc(Nc2ccccc2)nc1N |
| InChI | InChI=1S/C14H17N3OS/c1-14(2,3)11(18)10-12(15)17-13(19-10)16-9-7-5-4-6-8-9/h4-8H,15H2,1-3H3,(H,16,17) |
| InChIKey | ZBWOXOUOMPHDLR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-amino-2-anilino-1,3-thiazol-5-yl)-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-2-anilino-1,3-thiazol-5-yl)-2,2-dimethylpropan-1-one?
The IUPAC name of 1-(4-amino-2-anilino-1,3-thiazol-5-yl)-2,2-dimethylpropan-1-one (CID 973752) is 1-(4-amino-2-anilino-1,3-thiazol-5-yl)-2,2-dimethylpropan-1-one.
What is the SMILES notation for 1-(4-amino-2-anilino-1,3-thiazol-5-yl)-2,2-dimethylpropan-1-one?
The canonical SMILES for 1-(4-amino-2-anilino-1,3-thiazol-5-yl)-2,2-dimethylpropan-1-one is CC(C)(C)C(=O)c1sc(Nc2ccccc2)nc1N.
What is the InChIKey of 1-(4-amino-2-anilino-1,3-thiazol-5-yl)-2,2-dimethylpropan-1-one?
The InChIKey is ZBWOXOUOMPHDLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3OS/c1-14(2,3)11(18)10-12(15)17-13(19-10)16-9-7-5-4-6-8-9/h4-8H,15H2,1-3H3,(H,16,17).
What are the key properties of 1-(4-amino-2-anilino-1,3-thiazol-5-yl)-2,2-dimethylpropan-1-one?
1-(4-amino-2-anilino-1,3-thiazol-5-yl)-2,2-dimethylpropan-1-one has a molecular weight of 275.38 g/mol, XLogP of 3.70, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-2-anilino-1,3-thiazol-5-yl)-2,2-dimethylpropan-1-one is sourced from PubChem (CID 973752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).