C19H27N3O — CID 97375597
(5S,10S)-10-ethyl-1-prop-2-enyl-9-(pyridin-4-ylmethyl)-1,9-diazaspiro[4.5]decan-2-one (PubChem CID 97375597) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is (5S,10S)-10-ethyl-1-prop-2-enyl-9-(pyridin-4-ylmethyl)-1,9-diazaspiro[4.5]decan-2-one.
| Compound Name | (5S,10S)-10-ethyl-1-prop-2-enyl-9-(pyridin-4-ylmethyl)-1,9-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 97375597 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | (5S,10S)-10-ethyl-1-prop-2-enyl-9-(pyridin-4-ylmethyl)-1,9-diazaspiro[4.5]decan-2-one |
| SMILES | C=CCN1C(=O)CC[C@]12CCCN(Cc1ccncc1)[C@H]2CC |
| InChI | InChI=1S/C19H27N3O/c1-3-13-22-18(23)6-10-19(22)9-5-14-21(17(19)4-2)15-16-7-11-20-12-8-16/h3,7-8,11-12,17H,1,4-6,9-10,13-15H2,2H3/t17-,19-/m0/s1 |
| InChIKey | VMSJAPHIEBKXMP-HKUYNNGSSA-N |
| XLogP | 3.00 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|