C14H15N3OS2 — CID 97376780
(3aR,6aS)-2-(1,3-thiazol-2-ylmethyl)-5-thiophen-3-yl-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one (PubChem CID 97376780) has the molecular formula C14H15N3OS2 and a molecular weight of 305.43 g/mol. Its IUPAC name is (3aR,6aS)-2-(1,3-thiazol-2-ylmethyl)-5-thiophen-3-yl-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one.
| Compound Name | (3aR,6aS)-2-(1,3-thiazol-2-ylmethyl)-5-thiophen-3-yl-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one |
|---|---|
| PubChem CID | 97376780 |
| Molecular Formula | C14H15N3OS2 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | (3aR,6aS)-2-(1,3-thiazol-2-ylmethyl)-5-thiophen-3-yl-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one |
| SMILES | O=C1[C@H]2CN(Cc3nccs3)C[C@H]2CN1c1ccsc1 |
| InChI | InChI=1S/C14H15N3OS2/c18-14-12-7-16(8-13-15-2-4-20-13)5-10(12)6-17(14)11-1-3-19-9-11/h1-4,9-10,12H,5-8H2/t10-,12-/m0/s1 |
| InChIKey | DRWZUZSLLJOTLC-JQWIXIFHSA-N |
| XLogP | 2.30 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |