C10H13FN4 — CID 97376814
(3aR,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 97376814) has the molecular formula C10H13FN4 and a molecular weight of 208.24 g/mol. Its IUPAC name is (3aR,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | (3aR,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 97376814 |
| Molecular Formula | C10H13FN4 |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (3aR,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | Fc1cnc(N2C[C@H]3CNC[C@H]3C2)nc1 |
| InChI | InChI=1S/C10H13FN4/c11-9-3-13-10(14-4-9)15-5-7-1-12-2-8(7)6-15/h3-4,7-8,12H,1-2,5-6H2/t7-,8+ |
| InChIKey | RNGGDAUAYUXQHI-OCAPTIKFSA-N |
| XLogP | 0.27 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |