C11H21N3O — CID 97377198
(3aR,6aR)-N-(2-methylpropyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole-5-carboxamide (PubChem CID 97377198) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is (3aR,6aR)-N-(2-methylpropyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole-5-carboxamide.
| Compound Name | (3aR,6aR)-N-(2-methylpropyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 97377198 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | (3aR,6aR)-N-(2-methylpropyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole-5-carboxamide |
| SMILES | CC(C)CNC(=O)N1C[C@H]2CCN[C@H]2C1 |
| InChI | InChI=1S/C11H21N3O/c1-8(2)5-13-11(15)14-6-9-3-4-12-10(9)7-14/h8-10,12H,3-7H2,1-2H3,(H,13,15)/t9-,10+/m1/s1 |
| InChIKey | FWSAFPXGFQCQFK-ZJUUUORDSA-N |
| XLogP | 0.65 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |