C13H15F3N4O2 — CID 97377346
(4aR,7aR)-4-ethyl-6-[6-(trifluoromethyl)pyrimidin-4-yl]-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one (PubChem CID 97377346) has the molecular formula C13H15F3N4O2 and a molecular weight of 316.28 g/mol. Its IUPAC name is (4aR,7aR)-4-ethyl-6-[6-(trifluoromethyl)pyrimidin-4-yl]-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one.
| Compound Name | (4aR,7aR)-4-ethyl-6-[6-(trifluoromethyl)pyrimidin-4-yl]-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 97377346 |
| Molecular Formula | C13H15F3N4O2 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (4aR,7aR)-4-ethyl-6-[6-(trifluoromethyl)pyrimidin-4-yl]-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one |
| SMILES | CCN1C(=O)CO[C@@H]2CN(c3cc(C(F)(F)F)ncn3)C[C@H]21 |
| InChI | InChI=1S/C13H15F3N4O2/c1-2-20-8-4-19(5-9(8)22-6-12(20)21)11-3-10(13(14,15)16)17-7-18-11/h3,7-9H,2,4-6H2,1H3/t8-,9-/m1/s1 |
| InChIKey | PFYRXOJTZILJEV-RKDXNWHRSA-N |
| XLogP | 0.93 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |