C15H16N6O2 — CID 97377533
[(4aR,7aS)-4-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-pyridazin-4-ylmethanone (PubChem CID 97377533) has the molecular formula C15H16N6O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is [(4aR,7aS)-4-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-pyridazin-4-ylmethanone.
| Compound Name | [(4aR,7aS)-4-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-pyridazin-4-ylmethanone |
|---|---|
| PubChem CID | 97377533 |
| Molecular Formula | C15H16N6O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | [(4aR,7aS)-4-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-pyridazin-4-ylmethanone |
| SMILES | O=C(c1ccnnc1)N1C[C@@H]2OCCN(c3ncccn3)[C@@H]2C1 |
| InChI | InChI=1S/C15H16N6O2/c22-14(11-2-5-18-19-8-11)20-9-12-13(10-20)23-7-6-21(12)15-16-3-1-4-17-15/h1-5,8,12-13H,6-7,9-10H2/t12-,13+/m1/s1 |
| InChIKey | OLYQCVWXLLJOBX-OLZOCXBDSA-N |
| XLogP | -0.00 |
| TPSA | 84.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |