C12H20N2O2 — CID 97377565
[(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-4-yl]-cyclopentylmethanone (PubChem CID 97377565) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is [(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-4-yl]-cyclopentylmethanone.
| Compound Name | [(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-4-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 97377565 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | [(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-4-yl]-cyclopentylmethanone |
| SMILES | O=C(C1CCCC1)N1CCO[C@@H]2CNC[C@@H]21 |
| InChI | InChI=1S/C12H20N2O2/c15-12(9-3-1-2-4-9)14-5-6-16-11-8-13-7-10(11)14/h9-11,13H,1-8H2/t10-,11+/m0/s1 |
| InChIKey | OBAJJDVIEQKVFP-WDEREUQCSA-N |
| XLogP | 0.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |