C10H12FN3O — CID 97377893
(3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole (PubChem CID 97377893) has the molecular formula C10H12FN3O and a molecular weight of 209.22 g/mol. Its IUPAC name is (3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole.
| Compound Name | (3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole |
|---|---|
| PubChem CID | 97377893 |
| Molecular Formula | C10H12FN3O |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | (3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole |
| SMILES | Fc1cnc(N2C[C@@H]3COC[C@H]3C2)nc1 |
| InChI | InChI=1S/C10H12FN3O/c11-9-1-12-10(13-2-9)14-3-7-5-15-6-8(7)4-14/h1-2,7-8H,3-6H2/t7-,8-/m1/s1 |
| InChIKey | OQFXIUSAJGNDOQ-HTQZYQBOSA-N |
| XLogP | 0.70 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |