C14H21N3OS — CID 97377945
2-[[(7S,8aS)-7-prop-2-enoxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-1,3-thiazole (PubChem CID 97377945) has the molecular formula C14H21N3OS and a molecular weight of 279.41 g/mol. Its IUPAC name is 2-[[(7S,8aS)-7-prop-2-enoxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-1,3-thiazole.
| Compound Name | 2-[[(7S,8aS)-7-prop-2-enoxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 97377945 |
| Molecular Formula | C14H21N3OS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 2-[[(7S,8aS)-7-prop-2-enoxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-1,3-thiazole |
| SMILES | C=CCO[C@H]1C[C@H]2CN(Cc3nccs3)CCN2C1 |
| InChI | InChI=1S/C14H21N3OS/c1-2-6-18-13-8-12-9-16(4-5-17(12)10-13)11-14-15-3-7-19-14/h2-3,7,12-13H,1,4-6,8-11H2/t12-,13-/m0/s1 |
| InChIKey | PXTUZUPJWZYRDH-STQMWFEESA-N |
| XLogP | 1.60 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|