About (Z)-N-[[(1R,2S)-2-ethylsulfanyl-1-hydroxycyclobutyl]methyl]-2-methylpent-2-enamide
(Z)-N-[[(1R,2S)-2-ethylsulfanyl-1-hydroxycyclobutyl]methyl]-2-methylpent-2-enamide (PubChem CID 97378292) has the molecular formula C13H23NO2S
and a molecular weight of 257.40 g/mol. Its IUPAC name is (Z)-N-[[(1R,2S)-2-ethylsulfanyl-1-hydroxycyclobutyl]methyl]-2-methylpent-2-enamide.
Molecular Properties
| Compound Name | (Z)-N-[[(1R,2S)-2-ethylsulfanyl-1-hydroxycyclobutyl]methyl]-2-methylpent-2-enamide |
| PubChem CID | 97378292 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (Z)-N-[[(1R,2S)-2-ethylsulfanyl-1-hydroxycyclobutyl]methyl]-2-methylpent-2-enamide |
| SMILES | CC/C=C(/C)C(=O)NC[C@]1(O)CC[C@@H]1SCC |
| InChI | InChI=1S/C13H23NO2S/c1-4-6-10(3)12(15)14-9-13(16)8-7-11(13)17-5-2/h6,11,16H,4-5,7-9H2,1-3H3,(H,14,15)/b10-6-/t11-,13+/m0/s1 |
| InChIKey | FVBMFJBNPFRJFB-MLIUNOBVSA-N |
| XLogP | 2.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-[[(1R,2S)-2-ethylsulfanyl-1-hydroxycyclobutyl]methyl]-2-methylpent-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-[[(1R,2S)-2-ethylsulfanyl-1-hydroxycyclobutyl]methyl]-2-methylpent-2-enamide?
The IUPAC name of (Z)-N-[[(1R,2S)-2-ethylsulfanyl-1-hydroxycyclobutyl]methyl]-2-methylpent-2-enamide (CID 97378292) is (Z)-N-[[(1R,2S)-2-ethylsulfanyl-1-hydroxycyclobutyl]methyl]-2-methylpent-2-enamide.
What is the SMILES notation for (Z)-N-[[(1R,2S)-2-ethylsulfanyl-1-hydroxycyclobutyl]methyl]-2-methylpent-2-enamide?
The canonical SMILES for (Z)-N-[[(1R,2S)-2-ethylsulfanyl-1-hydroxycyclobutyl]methyl]-2-methylpent-2-enamide is CC/C=C(/C)C(=O)NC[C@]1(O)CC[C@@H]1SCC.
What is the InChIKey of (Z)-N-[[(1R,2S)-2-ethylsulfanyl-1-hydroxycyclobutyl]methyl]-2-methylpent-2-enamide?
The InChIKey is FVBMFJBNPFRJFB-MLIUNOBVSA-N. The full InChI is InChI=1S/C13H23NO2S/c1-4-6-10(3)12(15)14-9-13(16)8-7-11(13)17-5-2/h6,11,16H,4-5,7-9H2,1-3H3,(H,14,15)/b10-6-/t11-,13+/m0/s1.
What are the key properties of (Z)-N-[[(1R,2S)-2-ethylsulfanyl-1-hydroxycyclobutyl]methyl]-2-methylpent-2-enamide?
(Z)-N-[[(1R,2S)-2-ethylsulfanyl-1-hydroxycyclobutyl]methyl]-2-methylpent-2-enamide has a molecular weight of 257.40 g/mol, XLogP of 2.11, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-[[(1R,2S)-2-ethylsulfanyl-1-hydroxycyclobutyl]methyl]-2-methylpent-2-enamide is sourced from PubChem (CID 97378292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).