C13H19N3O3S2 — CID 97378410
(3aS,6aR)-1-ethylsulfonyl-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one (PubChem CID 97378410) has the molecular formula C13H19N3O3S2 and a molecular weight of 329.45 g/mol. Its IUPAC name is (3aS,6aR)-1-ethylsulfonyl-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one.
| Compound Name | (3aS,6aR)-1-ethylsulfonyl-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one |
|---|---|
| PubChem CID | 97378410 |
| Molecular Formula | C13H19N3O3S2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | (3aS,6aR)-1-ethylsulfonyl-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one |
| SMILES | CCS(=O)(=O)N1CC[C@H]2[C@H]1CC(=O)N2Cc1csc(C)n1 |
| InChI | InChI=1S/C13H19N3O3S2/c1-3-21(18,19)16-5-4-11-12(16)6-13(17)15(11)7-10-8-20-9(2)14-10/h8,11-12H,3-7H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | MUGBUGLVKZEMCF-NWDGAFQWSA-N |
| XLogP | 0.98 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |