C15H27N3O — CID 97378535
[(3aR,6aS)-1-(2-methylpropyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-pyrrolidin-1-ylmethanone (PubChem CID 97378535) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is [(3aR,6aS)-1-(2-methylpropyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(3aR,6aS)-1-(2-methylpropyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 97378535 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | [(3aR,6aS)-1-(2-methylpropyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-pyrrolidin-1-ylmethanone |
| SMILES | CC(C)CN1CC[C@@H]2[C@@H]1CCN2C(=O)N1CCCC1 |
| InChI | InChI=1S/C15H27N3O/c1-12(2)11-17-9-5-14-13(17)6-10-18(14)15(19)16-7-3-4-8-16/h12-14H,3-11H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | KGLPCNBJKYJXSE-UONOGXRCSA-N |
| XLogP | 2.01 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |