C16H19N3O2S — CID 97378633
(3S,3aR,6aS)-3-(pyridin-2-ylmethoxy)-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole (PubChem CID 97378633) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is (3S,3aR,6aS)-3-(pyridin-2-ylmethoxy)-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole.
| Compound Name | (3S,3aR,6aS)-3-(pyridin-2-ylmethoxy)-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole |
|---|---|
| PubChem CID | 97378633 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (3S,3aR,6aS)-3-(pyridin-2-ylmethoxy)-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole |
| SMILES | c1ccc(CO[C@@H]2CN(Cc3nccs3)[C@@H]3COC[C@@H]32)nc1 |
| InChI | InChI=1S/C16H19N3O2S/c1-2-4-17-12(3-1)9-21-15-7-19(8-16-18-5-6-22-16)14-11-20-10-13(14)15/h1-6,13-15H,7-11H2/t13-,14+,15+/m0/s1 |
| InChIKey | BZDVUBSFDSHSLL-RRFJBIMHSA-N |
| XLogP | 1.95 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |