C19H28N4O3 — CID 97378657
ethyl (3aR,8aR)-2-propan-2-yl-5-(pyrazine-2-carbonyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate (PubChem CID 97378657) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is ethyl (3aR,8aR)-2-propan-2-yl-5-(pyrazine-2-carbonyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate.
| Compound Name | ethyl (3aR,8aR)-2-propan-2-yl-5-(pyrazine-2-carbonyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate |
|---|---|
| PubChem CID | 97378657 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | ethyl (3aR,8aR)-2-propan-2-yl-5-(pyrazine-2-carbonyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate |
| SMILES | CCOC(=O)[C@]12CCCN(C(=O)c3cnccn3)C[C@H]1CN(C(C)C)C2 |
| InChI | InChI=1S/C19H28N4O3/c1-4-26-18(25)19-6-5-9-22(17(24)16-10-20-7-8-21-16)11-15(19)12-23(13-19)14(2)3/h7-8,10,14-15H,4-6,9,11-13H2,1-3H3/t15-,19-/m0/s1 |
| InChIKey | FNUGDKAHCHKFNE-KXBFYZLASA-N |
| XLogP | 1.60 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |