C20H34N4O2 — CID 97378669
ethyl (3aS,8aR)-2-(2-methylpropyl)-5-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate (PubChem CID 97378669) has the molecular formula C20H34N4O2 and a molecular weight of 362.52 g/mol. Its IUPAC name is ethyl (3aS,8aR)-2-(2-methylpropyl)-5-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate.
| Compound Name | ethyl (3aS,8aR)-2-(2-methylpropyl)-5-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate |
|---|---|
| PubChem CID | 97378669 |
| Molecular Formula | C20H34N4O2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | ethyl (3aS,8aR)-2-(2-methylpropyl)-5-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate |
| SMILES | CCOC(=O)[C@]12CCCN(Cc3cnn(C)c3)C[C@H]1CN(CC(C)C)C2 |
| InChI | InChI=1S/C20H34N4O2/c1-5-26-19(25)20-7-6-8-23(12-17-9-21-22(4)11-17)13-18(20)14-24(15-20)10-16(2)3/h9,11,16,18H,5-8,10,12-15H2,1-4H3/t18-,20-/m0/s1 |
| InChIKey | WLJXXHMJRRUVPR-ICSRJNTNSA-N |
| XLogP | 2.15 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |