C19H31N3O2S — CID 97378670
ethyl (3aR,8aR)-2-(2-methylpropyl)-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate (PubChem CID 97378670) has the molecular formula C19H31N3O2S and a molecular weight of 365.54 g/mol. Its IUPAC name is ethyl (3aR,8aR)-2-(2-methylpropyl)-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate.
| Compound Name | ethyl (3aR,8aR)-2-(2-methylpropyl)-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate |
|---|---|
| PubChem CID | 97378670 |
| Molecular Formula | C19H31N3O2S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | ethyl (3aR,8aR)-2-(2-methylpropyl)-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate |
| SMILES | CCOC(=O)[C@]12CCCN(Cc3nccs3)C[C@H]1CN(CC(C)C)C2 |
| InChI | InChI=1S/C19H31N3O2S/c1-4-24-18(23)19-6-5-8-21(13-17-20-7-9-25-17)11-16(19)12-22(14-19)10-15(2)3/h7,9,15-16H,4-6,8,10-14H2,1-3H3/t16-,19-/m0/s1 |
| InChIKey | GOLBUJSUGCQICC-LPHOPBHVSA-N |
| XLogP | 2.88 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |