C19H32N4O2S — CID 97378678
ethyl (3aR,8aR)-2-[2-(dimethylamino)ethyl]-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate (PubChem CID 97378678) has the molecular formula C19H32N4O2S and a molecular weight of 380.56 g/mol. Its IUPAC name is ethyl (3aR,8aR)-2-[2-(dimethylamino)ethyl]-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate.
| Compound Name | ethyl (3aR,8aR)-2-[2-(dimethylamino)ethyl]-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate |
|---|---|
| PubChem CID | 97378678 |
| Molecular Formula | C19H32N4O2S |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | ethyl (3aR,8aR)-2-[2-(dimethylamino)ethyl]-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate |
| SMILES | CCOC(=O)[C@]12CCCN(Cc3nccs3)C[C@H]1CN(CCN(C)C)C2 |
| InChI | InChI=1S/C19H32N4O2S/c1-4-25-18(24)19-6-5-8-22(14-17-20-7-11-26-17)12-16(19)13-23(15-19)10-9-21(2)3/h7,11,16H,4-6,8-10,12-15H2,1-3H3/t16-,19-/m0/s1 |
| InChIKey | FJHWPFBBWIORNF-LPHOPBHVSA-N |
| XLogP | 1.78 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |