C20H31N5O3 — CID 97378688
ethyl (3aR,8aR)-2-[2-(dimethylamino)ethyl]-5-(pyrazine-2-carbonyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate (PubChem CID 97378688) has the molecular formula C20H31N5O3 and a molecular weight of 389.50 g/mol. Its IUPAC name is ethyl (3aR,8aR)-2-[2-(dimethylamino)ethyl]-5-(pyrazine-2-carbonyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate.
| Compound Name | ethyl (3aR,8aR)-2-[2-(dimethylamino)ethyl]-5-(pyrazine-2-carbonyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate |
|---|---|
| PubChem CID | 97378688 |
| Molecular Formula | C20H31N5O3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | ethyl (3aR,8aR)-2-[2-(dimethylamino)ethyl]-5-(pyrazine-2-carbonyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate |
| SMILES | CCOC(=O)[C@]12CCCN(C(=O)c3cnccn3)C[C@H]1CN(CCN(C)C)C2 |
| InChI | InChI=1S/C20H31N5O3/c1-4-28-19(27)20-6-5-9-25(18(26)17-12-21-7-8-22-17)14-16(20)13-24(15-20)11-10-23(2)3/h7-8,12,16H,4-6,9-11,13-15H2,1-3H3/t16-,20+/m1/s1 |
| InChIKey | FJPJRDUPJJGHCP-UZLBHIALSA-N |
| XLogP | 0.76 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |