C16H25N3O4S2 — CID 97378735
ethyl (3aS,8aR)-2-methylsulfonyl-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate (PubChem CID 97378735) has the molecular formula C16H25N3O4S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is ethyl (3aS,8aR)-2-methylsulfonyl-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate.
| Compound Name | ethyl (3aS,8aR)-2-methylsulfonyl-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate |
|---|---|
| PubChem CID | 97378735 |
| Molecular Formula | C16H25N3O4S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | ethyl (3aS,8aR)-2-methylsulfonyl-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate |
| SMILES | CCOC(=O)[C@]12CCCN(Cc3nccs3)C[C@H]1CN(S(C)(=O)=O)C2 |
| InChI | InChI=1S/C16H25N3O4S2/c1-3-23-15(20)16-5-4-7-18(11-14-17-6-8-24-14)9-13(16)10-19(12-16)25(2,21)22/h6,8,13H,3-5,7,9-12H2,1-2H3/t13-,16-/m0/s1 |
| InChIKey | GURRFRUERWYHAC-BBRMVZONSA-N |
| XLogP | 1.18 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |