C18H27N5O2 — CID 97379005
[(3S,3aR,7aR)-3-[(4-methylpiperazin-1-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-pyrazin-2-ylmethanone (PubChem CID 97379005) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is [(3S,3aR,7aR)-3-[(4-methylpiperazin-1-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(3S,3aR,7aR)-3-[(4-methylpiperazin-1-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 97379005 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | [(3S,3aR,7aR)-3-[(4-methylpiperazin-1-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-pyrazin-2-ylmethanone |
| SMILES | CN1CCN(C[C@H]2OC[C@@H]3CCN(C(=O)c4cnccn4)C[C@@H]32)CC1 |
| InChI | InChI=1S/C18H27N5O2/c1-21-6-8-22(9-7-21)12-17-15-11-23(5-2-14(15)13-25-17)18(24)16-10-19-3-4-20-16/h3-4,10,14-15,17H,2,5-9,11-13H2,1H3/t14-,15-,17+/m0/s1 |
| InChIKey | SHNHNDSKLHHHLU-YQQAZPJKSA-N |
| XLogP | 0.20 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |