C17H28N4O3 — CID 97379137
2-[[(3aR,5R,7aR)-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]methoxy]-N,N-dimethylacetamide (PubChem CID 97379137) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-[[(3aR,5R,7aR)-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]methoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[[(3aR,5R,7aR)-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]methoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 97379137 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 2-[[(3aR,5R,7aR)-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]methoxy]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)COC[C@H]1CC[C@@H]2[C@@H](CCN2Cc2cnn(C)c2)O1 |
| InChI | InChI=1S/C17H28N4O3/c1-19(2)17(22)12-23-11-14-4-5-15-16(24-14)6-7-21(15)10-13-8-18-20(3)9-13/h8-9,14-16H,4-7,10-12H2,1-3H3/t14-,15-,16-/m1/s1 |
| InChIKey | BTTOWSKXFUWLKC-BZUAXINKSA-N |
| XLogP | 0.65 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |