C21H30FNO3 — CID 97379164
(3aR,5R,7aR)-1-[(4-fluorophenyl)methyl]-5-(oxan-4-ylmethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole (PubChem CID 97379164) has the molecular formula C21H30FNO3 and a molecular weight of 363.47 g/mol. Its IUPAC name is (3aR,5R,7aR)-1-[(4-fluorophenyl)methyl]-5-(oxan-4-ylmethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole.
| Compound Name | (3aR,5R,7aR)-1-[(4-fluorophenyl)methyl]-5-(oxan-4-ylmethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
|---|---|
| PubChem CID | 97379164 |
| Molecular Formula | C21H30FNO3 |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (3aR,5R,7aR)-1-[(4-fluorophenyl)methyl]-5-(oxan-4-ylmethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
| SMILES | Fc1ccc(CN2CC[C@H]3O[C@@H](COCC4CCOCC4)CC[C@H]32)cc1 |
| InChI | InChI=1S/C21H30FNO3/c22-18-3-1-16(2-4-18)13-23-10-7-21-20(23)6-5-19(26-21)15-25-14-17-8-11-24-12-9-17/h1-4,17,19-21H,5-15H2/t19-,20-,21-/m1/s1 |
| InChIKey | SKMUOYOTBQGKFQ-NJDAHSKKSA-N |
| XLogP | 3.39 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |