C16H25N3O3 — CID 97379227
(3aS,7aR)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-(2-methoxyethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one (PubChem CID 97379227) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is (3aS,7aR)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-(2-methoxyethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one.
| Compound Name | (3aS,7aR)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-(2-methoxyethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 97379227 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (3aS,7aR)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-(2-methoxyethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one |
| SMILES | COCCN1C(=O)CC[C@@H]2[C@@H]1CCN2Cc1c(C)noc1C |
| InChI | InChI=1S/C16H25N3O3/c1-11-13(12(2)22-17-11)10-18-7-6-15-14(18)4-5-16(20)19(15)8-9-21-3/h14-15H,4-10H2,1-3H3/t14-,15+/m1/s1 |
| InChIKey | CQUITKGKHFRSFB-CABCVRRESA-N |
| XLogP | 1.50 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |