C21H24FN3O — CID 97379374
(3aR,7aR)-1-[(4-fluorophenyl)methyl]-4-[(6-methyl-2-pyridinyl)methyl]-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one (PubChem CID 97379374) has the molecular formula C21H24FN3O and a molecular weight of 353.44 g/mol. Its IUPAC name is (3aR,7aR)-1-[(4-fluorophenyl)methyl]-4-[(6-methyl-2-pyridinyl)methyl]-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one.
| Compound Name | (3aR,7aR)-1-[(4-fluorophenyl)methyl]-4-[(6-methyl-2-pyridinyl)methyl]-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 97379374 |
| Molecular Formula | C21H24FN3O |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | (3aR,7aR)-1-[(4-fluorophenyl)methyl]-4-[(6-methyl-2-pyridinyl)methyl]-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one |
| SMILES | Cc1cccc(CN2C(=O)CC[C@@H]3[C@H]2CCN3Cc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C21H24FN3O/c1-15-3-2-4-18(23-15)14-25-20-11-12-24(19(20)9-10-21(25)26)13-16-5-7-17(22)8-6-16/h2-8,19-20H,9-14H2,1H3/t19-,20-/m1/s1 |
| InChIKey | VYPBGVQPCLQZDK-WOJBJXKFSA-N |
| XLogP | 3.29 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |