C16H23N3O3S — CID 97379387
(3aR,7aR)-1-ethylsulfonyl-4-[(6-methyl-2-pyridinyl)methyl]-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one (PubChem CID 97379387) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is (3aR,7aR)-1-ethylsulfonyl-4-[(6-methyl-2-pyridinyl)methyl]-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one.
| Compound Name | (3aR,7aR)-1-ethylsulfonyl-4-[(6-methyl-2-pyridinyl)methyl]-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 97379387 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (3aR,7aR)-1-ethylsulfonyl-4-[(6-methyl-2-pyridinyl)methyl]-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one |
| SMILES | CCS(=O)(=O)N1CC[C@@H]2[C@H]1CCC(=O)N2Cc1cccc(C)n1 |
| InChI | InChI=1S/C16H23N3O3S/c1-3-23(21,22)19-10-9-14-15(19)7-8-16(20)18(14)11-13-6-4-5-12(2)17-13/h4-6,14-15H,3,7-11H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | SRBDLHFQICJMLO-HUUCEWRRSA-N |
| XLogP | 1.31 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |