C15H23N3O2S — CID 97379425
(4aR,6S,7aR)-N-propan-2-yl-4-(1,3-thiazol-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-6-carboxamide (PubChem CID 97379425) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is (4aR,6S,7aR)-N-propan-2-yl-4-(1,3-thiazol-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-6-carboxamide.
| Compound Name | (4aR,6S,7aR)-N-propan-2-yl-4-(1,3-thiazol-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-6-carboxamide |
|---|---|
| PubChem CID | 97379425 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (4aR,6S,7aR)-N-propan-2-yl-4-(1,3-thiazol-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-6-carboxamide |
| SMILES | CC(C)NC(=O)[C@H]1C[C@@H]2[C@@H](C1)OCCN2Cc1nccs1 |
| InChI | InChI=1S/C15H23N3O2S/c1-10(2)17-15(19)11-7-12-13(8-11)20-5-4-18(12)9-14-16-3-6-21-14/h3,6,10-13H,4-5,7-9H2,1-2H3,(H,17,19)/t11-,12+,13+/m0/s1 |
| InChIKey | MDKCKRKBQCQTJR-YNEHKIRRSA-N |
| XLogP | 1.65 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |