C20H27FN2O3 — CID 97379948
2-[(3aR,7S,7aS)-2-[(4-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-morpholin-4-ylethanone (PubChem CID 97379948) has the molecular formula C20H27FN2O3 and a molecular weight of 362.45 g/mol. Its IUPAC name is 2-[(3aR,7S,7aS)-2-[(4-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[(3aR,7S,7aS)-2-[(4-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 97379948 |
| Molecular Formula | C20H27FN2O3 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 2-[(3aR,7S,7aS)-2-[(4-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-morpholin-4-ylethanone |
| SMILES | O=C(C[C@@H]1COC[C@H]2CN(Cc3ccc(F)cc3)C[C@@H]12)N1CCOCC1 |
| InChI | InChI=1S/C20H27FN2O3/c21-18-3-1-15(2-4-18)10-22-11-17-14-26-13-16(19(17)12-22)9-20(24)23-5-7-25-8-6-23/h1-4,16-17,19H,5-14H2/t16-,17-,19+/m1/s1 |
| InChIKey | YQENBWOCWAFJIV-LMMKCTJWSA-N |
| XLogP | 1.77 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |