C16H26N4O3 — CID 97380043
(3aR,5S,7aR)-N-(2-methoxyethyl)-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide (PubChem CID 97380043) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is (3aR,5S,7aR)-N-(2-methoxyethyl)-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide.
| Compound Name | (3aR,5S,7aR)-N-(2-methoxyethyl)-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 97380043 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (3aR,5S,7aR)-N-(2-methoxyethyl)-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1CC[C@@H]2[C@@H](CCN2Cc2cnn(C)c2)O1 |
| InChI | InChI=1S/C16H26N4O3/c1-19-10-12(9-18-19)11-20-7-5-14-13(20)3-4-15(23-14)16(21)17-6-8-22-2/h9-10,13-15H,3-8,11H2,1-2H3,(H,17,21)/t13-,14-,15+/m1/s1 |
| InChIKey | DVYQAVSNOMTAGM-KFWWJZLASA-N |
| XLogP | 0.30 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|